C14H19FN4O2 — CID 115497212
6-fluoro-N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]pyridine-2-carboxamide (PubChem CID 115497212) has the molecular formula C14H19FN4O2 and a molecular weight of 294.33 g/mol. Its IUPAC name is 6-fluoro-N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]pyridine-2-carboxamide.
| Compound Name | 6-fluoro-N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 115497212 |
| Molecular Formula | C14H19FN4O2 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 6-fluoro-N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]pyridine-2-carboxamide |
| SMILES | CNC(=O)CN1CCC(NC(=O)c2cccc(F)n2)CC1 |
| InChI | InChI=1S/C14H19FN4O2/c1-16-13(20)9-19-7-5-10(6-8-19)17-14(21)11-3-2-4-12(15)18-11/h2-4,10H,5-9H2,1H3,(H,16,20)(H,17,21) |
| InChIKey | LMQDIOVOZGDWPD-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|