C18H23N5O2 — CID 51078940
N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]-1-phenylpyrazole-3-carboxamide (PubChem CID 51078940) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 51078940 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]-1-phenylpyrazole-3-carboxamide |
| SMILES | CNC(=O)CN1CCC(NC(=O)c2ccn(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C18H23N5O2/c1-19-17(24)13-22-10-7-14(8-11-22)20-18(25)16-9-12-23(21-16)15-5-3-2-4-6-15/h2-6,9,12,14H,7-8,10-11,13H2,1H3,(H,19,24)(H,20,25) |
| InChIKey | YLPKPYDGKLBOFF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |