C12H20ClN3O — CID 113442476
[2-[(5-chloro-1-methylimidazol-2-yl)methylamino]cyclohexyl]methanol (PubChem CID 113442476) has the molecular formula C12H20ClN3O and a molecular weight of 257.76 g/mol. Its IUPAC name is [2-[(5-chloro-1-methylimidazol-2-yl)methylamino]cyclohexyl]methanol.
| Compound Name | [2-[(5-chloro-1-methylimidazol-2-yl)methylamino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 113442476 |
| Molecular Formula | C12H20ClN3O |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | [2-[(5-chloro-1-methylimidazol-2-yl)methylamino]cyclohexyl]methanol |
| SMILES | Cn1c(Cl)cnc1CNC1CCCCC1CO |
| InChI | InChI=1S/C12H20ClN3O/c1-16-11(13)6-15-12(16)7-14-10-5-3-2-4-9(10)8-17/h6,9-10,14,17H,2-5,7-8H2,1H3 |
| InChIKey | HWTLIOHAQVYUBI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |