C11H18ClN3 — CID 115653164
N-[(5-chloro-1-methylimidazol-2-yl)methyl]-3-methylcyclopentan-1-amine (PubChem CID 115653164) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is N-[(5-chloro-1-methylimidazol-2-yl)methyl]-3-methylcyclopentan-1-amine.
| Compound Name | N-[(5-chloro-1-methylimidazol-2-yl)methyl]-3-methylcyclopentan-1-amine |
|---|---|
| PubChem CID | 115653164 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | N-[(5-chloro-1-methylimidazol-2-yl)methyl]-3-methylcyclopentan-1-amine |
| SMILES | CC1CCC(NCc2ncc(Cl)n2C)C1 |
| InChI | InChI=1S/C11H18ClN3/c1-8-3-4-9(5-8)13-7-11-14-6-10(12)15(11)2/h6,8-9,13H,3-5,7H2,1-2H3 |
| InChIKey | VVPUHWDDOUPMLA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |