C15H17BrClN3O — CID 60881433
N-[[5-bromo-2-[(5-chloro-1-methylimidazol-2-yl)methoxy]phenyl]methyl]cyclopropanamine (PubChem CID 60881433) has the molecular formula C15H17BrClN3O and a molecular weight of 370.68 g/mol. Its IUPAC name is N-[[5-bromo-2-[(5-chloro-1-methylimidazol-2-yl)methoxy]phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[5-bromo-2-[(5-chloro-1-methylimidazol-2-yl)methoxy]phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 60881433 |
| Molecular Formula | C15H17BrClN3O |
| Molecular Weight | 370.68 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | N-[[5-bromo-2-[(5-chloro-1-methylimidazol-2-yl)methoxy]phenyl]methyl]cyclopropanamine |
| SMILES | Cn1c(Cl)cnc1COc1ccc(Br)cc1CNC1CC1 |
| InChI | InChI=1S/C15H17BrClN3O/c1-20-14(17)8-19-15(20)9-21-13-5-2-11(16)6-10(13)7-18-12-3-4-12/h2,5-6,8,12,18H,3-4,7,9H2,1H3 |
| InChIKey | HPETXVWHNQANQZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.68 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |