C13H15Cl2N3O — CID 60881259
1-[5-chloro-2-[(5-chloro-1-methylimidazol-2-yl)methoxy]phenyl]-N-methylmethanamine (PubChem CID 60881259) has the molecular formula C13H15Cl2N3O and a molecular weight of 300.19 g/mol. Its IUPAC name is 1-[5-chloro-2-[(5-chloro-1-methylimidazol-2-yl)methoxy]phenyl]-N-methylmethanamine.
| Compound Name | 1-[5-chloro-2-[(5-chloro-1-methylimidazol-2-yl)methoxy]phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 60881259 |
| Molecular Formula | C13H15Cl2N3O |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 1-[5-chloro-2-[(5-chloro-1-methylimidazol-2-yl)methoxy]phenyl]-N-methylmethanamine |
| SMILES | CNCc1cc(Cl)ccc1OCc1ncc(Cl)n1C |
| InChI | InChI=1S/C13H15Cl2N3O/c1-16-6-9-5-10(14)3-4-11(9)19-8-13-17-7-12(15)18(13)2/h3-5,7,16H,6,8H2,1-2H3 |
| InChIKey | ADRPEXNOTXHZBB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |