C11H18O2 — CID 11344383
2-hydroxy-2-methyl-1-[(1S,2R)-2-methylcyclohex-3-en-1-yl]propan-1-one (PubChem CID 11344383) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-1-[(1S,2R)-2-methylcyclohex-3-en-1-yl]propan-1-one.
| Compound Name | 2-hydroxy-2-methyl-1-[(1S,2R)-2-methylcyclohex-3-en-1-yl]propan-1-one |
|---|---|
| PubChem CID | 11344383 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 2-hydroxy-2-methyl-1-[(1S,2R)-2-methylcyclohex-3-en-1-yl]propan-1-one |
| SMILES | C[C@@H]1C=CCC[C@@H]1C(=O)C(C)(C)O |
| InChI | InChI=1S/C11H18O2/c1-8-6-4-5-7-9(8)10(12)11(2,3)13/h4,6,8-9,13H,5,7H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | MZMCZTVVMDHCMN-BDAKNGLRSA-N |
| XLogP | 1.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|