C10H11N3O — CID 11344484
4-(5-ethyl-1,2,4-oxadiazol-3-yl)aniline (PubChem CID 11344484) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 4-(5-ethyl-1,2,4-oxadiazol-3-yl)aniline.
| Compound Name | 4-(5-ethyl-1,2,4-oxadiazol-3-yl)aniline |
|---|---|
| PubChem CID | 11344484 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 4-(5-ethyl-1,2,4-oxadiazol-3-yl)aniline |
| SMILES | CCc1nc(-c2ccc(N)cc2)no1 |
| InChI | InChI=1S/C10H11N3O/c1-2-9-12-10(13-14-9)7-3-5-8(11)6-4-7/h3-6H,2,11H2,1H3 |
| InChIKey | GBCCZEVTBFBSTB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|