C11H23N3O3 — CID 113450352
N'-hydroxy-5-[(3-methoxyoxolan-3-yl)methylamino]pentanimidamide (PubChem CID 113450352) has the molecular formula C11H23N3O3 and a molecular weight of 245.32 g/mol. Its IUPAC name is N'-hydroxy-5-[(3-methoxyoxolan-3-yl)methylamino]pentanimidamide.
| Compound Name | N'-hydroxy-5-[(3-methoxyoxolan-3-yl)methylamino]pentanimidamide |
|---|---|
| PubChem CID | 113450352 |
| Molecular Formula | C11H23N3O3 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | N'-hydroxy-5-[(3-methoxyoxolan-3-yl)methylamino]pentanimidamide |
| SMILES | COC1(CNCCCCC(N)=NO)CCOC1 |
| InChI | InChI=1S/C11H23N3O3/c1-16-11(5-7-17-9-11)8-13-6-3-2-4-10(12)14-15/h13,15H,2-9H2,1H3,(H2,12,14) |
| InChIKey | ZFBSRKQSJYJSBU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|