C15H20ClFO — CID 113453828
1-[(2-chloro-5-methylcyclohexyl)methyl]-2-fluoro-3-methoxybenzene (PubChem CID 113453828) has the molecular formula C15H20ClFO and a molecular weight of 270.77 g/mol. Its IUPAC name is 1-[(2-chloro-5-methylcyclohexyl)methyl]-2-fluoro-3-methoxybenzene.
| Compound Name | 1-[(2-chloro-5-methylcyclohexyl)methyl]-2-fluoro-3-methoxybenzene |
|---|---|
| PubChem CID | 113453828 |
| Molecular Formula | C15H20ClFO |
| Molecular Weight | 270.77 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-[(2-chloro-5-methylcyclohexyl)methyl]-2-fluoro-3-methoxybenzene |
| SMILES | COc1cccc(CC2CC(C)CCC2Cl)c1F |
| InChI | InChI=1S/C15H20ClFO/c1-10-6-7-13(16)12(8-10)9-11-4-3-5-14(18-2)15(11)17/h3-5,10,12-13H,6-9H2,1-2H3 |
| InChIKey | MEOVJAWIGIRZKT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.77 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|