C18H26ClFO — CID 104795179
1-[2-(2-chloro-4-methylcyclohexyl)-2-methylpropyl]-2-fluoro-3-methoxybenzene (PubChem CID 104795179) has the molecular formula C18H26ClFO and a molecular weight of 312.86 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-methylcyclohexyl)-2-methylpropyl]-2-fluoro-3-methoxybenzene.
| Compound Name | 1-[2-(2-chloro-4-methylcyclohexyl)-2-methylpropyl]-2-fluoro-3-methoxybenzene |
|---|---|
| PubChem CID | 104795179 |
| Molecular Formula | C18H26ClFO |
| Molecular Weight | 312.86 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-[2-(2-chloro-4-methylcyclohexyl)-2-methylpropyl]-2-fluoro-3-methoxybenzene |
| SMILES | COc1cccc(CC(C)(C)C2CCC(C)CC2Cl)c1F |
| InChI | InChI=1S/C18H26ClFO/c1-12-8-9-14(15(19)10-12)18(2,3)11-13-6-5-7-16(21-4)17(13)20/h5-7,12,14-15H,8-11H2,1-4H3 |
| InChIKey | QECYTMDOIJMMGY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.86 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|