C18H26BrClO — CID 64767519
2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-4-chloro-1-methoxybenzene (PubChem CID 64767519) has the molecular formula C18H26BrClO and a molecular weight of 373.76 g/mol. Its IUPAC name is 2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-4-chloro-1-methoxybenzene.
| Compound Name | 2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-4-chloro-1-methoxybenzene |
|---|---|
| PubChem CID | 64767519 |
| Molecular Formula | C18H26BrClO |
| Molecular Weight | 373.76 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-4-chloro-1-methoxybenzene |
| SMILES | COc1ccc(Cl)cc1CC(C)(C)C1CCC(C)CC1Br |
| InChI | InChI=1S/C18H26BrClO/c1-12-5-7-15(16(19)9-12)18(2,3)11-13-10-14(20)6-8-17(13)21-4/h6,8,10,12,15-16H,5,7,9,11H2,1-4H3 |
| InChIKey | GGWAONZQGPPOAI-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.76 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|