C17H23BrClF — CID 115984393
1-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-2-chloro-3-fluorobenzene (PubChem CID 115984393) has the molecular formula C17H23BrClF and a molecular weight of 361.73 g/mol. Its IUPAC name is 1-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-2-chloro-3-fluorobenzene.
| Compound Name | 1-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-2-chloro-3-fluorobenzene |
|---|---|
| PubChem CID | 115984393 |
| Molecular Formula | C17H23BrClF |
| Molecular Weight | 361.73 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 1-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-2-chloro-3-fluorobenzene |
| SMILES | CC1CCC(C(C)(C)Cc2cccc(F)c2Cl)C(Br)C1 |
| InChI | InChI=1S/C17H23BrClF/c1-11-7-8-13(14(18)9-11)17(2,3)10-12-5-4-6-15(20)16(12)19/h4-6,11,13-14H,7-10H2,1-3H3 |
| InChIKey | CJOCYNLSWBKWCS-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.73 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|