C17H24BrI — CID 65489176
1-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-4-iodobenzene (PubChem CID 65489176) has the molecular formula C17H24BrI and a molecular weight of 435.19 g/mol. Its IUPAC name is 1-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-4-iodobenzene.
| Compound Name | 1-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-4-iodobenzene |
|---|---|
| PubChem CID | 65489176 |
| Molecular Formula | C17H24BrI |
| Molecular Weight | 435.19 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | 1-[2-(2-bromo-4-methylcyclohexyl)-2-methylpropyl]-4-iodobenzene |
| SMILES | CC1CCC(C(C)(C)Cc2ccc(I)cc2)C(Br)C1 |
| InChI | InChI=1S/C17H24BrI/c1-12-4-9-15(16(18)10-12)17(2,3)11-13-5-7-14(19)8-6-13/h5-8,12,15-16H,4,9-11H2,1-3H3 |
| InChIKey | MKXAOQNXEAZFQS-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.19 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|