C14H21ClFNO — CID 113453891
3-(chloromethyl)-N-[(2-fluoro-3-methoxyphenyl)methyl]pentan-3-amine (PubChem CID 113453891) has the molecular formula C14H21ClFNO and a molecular weight of 273.78 g/mol. Its IUPAC name is 3-(chloromethyl)-N-[(2-fluoro-3-methoxyphenyl)methyl]pentan-3-amine.
| Compound Name | 3-(chloromethyl)-N-[(2-fluoro-3-methoxyphenyl)methyl]pentan-3-amine |
|---|---|
| PubChem CID | 113453891 |
| Molecular Formula | C14H21ClFNO |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 3-(chloromethyl)-N-[(2-fluoro-3-methoxyphenyl)methyl]pentan-3-amine |
| SMILES | CCC(CC)(CCl)NCc1cccc(OC)c1F |
| InChI | InChI=1S/C14H21ClFNO/c1-4-14(5-2,10-15)17-9-11-7-6-8-12(18-3)13(11)16/h6-8,17H,4-5,9-10H2,1-3H3 |
| InChIKey | WTVFLERSRIHVJC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|