C14H17F2NO — CID 113455301
N-[(3,5-difluoro-4-pent-3-ynoxyphenyl)methyl]ethanamine (PubChem CID 113455301) has the molecular formula C14H17F2NO and a molecular weight of 253.29 g/mol. Its IUPAC name is N-[(3,5-difluoro-4-pent-3-ynoxyphenyl)methyl]ethanamine.
| Compound Name | N-[(3,5-difluoro-4-pent-3-ynoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 113455301 |
| Molecular Formula | C14H17F2NO |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-[(3,5-difluoro-4-pent-3-ynoxyphenyl)methyl]ethanamine |
| SMILES | CC#CCCOc1c(F)cc(CNCC)cc1F |
| InChI | InChI=1S/C14H17F2NO/c1-3-5-6-7-18-14-12(15)8-11(9-13(14)16)10-17-4-2/h8-9,17H,4,6-7,10H2,1-2H3 |
| InChIKey | PNSJFYJLLWNGCH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|