C13H17N3O2 — CID 113457829
1-(3,3-dimethylbutan-2-yl)benzotriazole-4-carboxylic acid (PubChem CID 113457829) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-(3,3-dimethylbutan-2-yl)benzotriazole-4-carboxylic acid.
| Compound Name | 1-(3,3-dimethylbutan-2-yl)benzotriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 113457829 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 1-(3,3-dimethylbutan-2-yl)benzotriazole-4-carboxylic acid |
| SMILES | CC(n1nnc2c(C(=O)O)cccc21)C(C)(C)C |
| InChI | InChI=1S/C13H17N3O2/c1-8(13(2,3)4)16-10-7-5-6-9(12(17)18)11(10)14-15-16/h5-8H,1-4H3,(H,17,18) |
| InChIKey | UTELFTBTQURYGH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |