C14H13IN2O2 — CID 113459432
2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-5-iodopyrimidine (PubChem CID 113459432) has the molecular formula C14H13IN2O2 and a molecular weight of 368.17 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-5-iodopyrimidine.
| Compound Name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-5-iodopyrimidine |
|---|---|
| PubChem CID | 113459432 |
| Molecular Formula | C14H13IN2O2 |
| Molecular Weight | 368.17 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-5-iodopyrimidine |
| SMILES | CC1(C)Cc2cccc(Oc3ncc(I)cn3)c2O1 |
| InChI | InChI=1S/C14H13IN2O2/c1-14(2)6-9-4-3-5-11(12(9)19-14)18-13-16-7-10(15)8-17-13/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | KMPXOJVIDJHZAN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.17 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|