C12H21NO5 — CID 11345962
tert-butyl 2-[(1R,2R,3R)-3-hydroxy-2-nitrocyclohexyl]acetate (PubChem CID 11345962) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is tert-butyl 2-[(1R,2R,3R)-3-hydroxy-2-nitrocyclohexyl]acetate.
| Compound Name | tert-butyl 2-[(1R,2R,3R)-3-hydroxy-2-nitrocyclohexyl]acetate |
|---|---|
| PubChem CID | 11345962 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | tert-butyl 2-[(1R,2R,3R)-3-hydroxy-2-nitrocyclohexyl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1CCC[C@@H](O)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C12H21NO5/c1-12(2,3)18-10(15)7-8-5-4-6-9(14)11(8)13(16)17/h8-9,11,14H,4-7H2,1-3H3/t8-,9-,11-/m1/s1 |
| InChIKey | KPYKAVOGALTIIM-FXPVBKGRSA-N |
| XLogP | 1.52 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|