C13H20O6 — CID 11346311
(3S,4S,5S)-3-[(2S)-but-3-en-2-yl]-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxyoxolan-2-one (PubChem CID 11346311) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is (3S,4S,5S)-3-[(2S)-but-3-en-2-yl]-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxyoxolan-2-one.
| Compound Name | (3S,4S,5S)-3-[(2S)-but-3-en-2-yl]-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxyoxolan-2-one |
|---|---|
| PubChem CID | 11346311 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (3S,4S,5S)-3-[(2S)-but-3-en-2-yl]-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxyoxolan-2-one |
| SMILES | C=C[C@H](C)[C@@]1(O)C(=O)O[C@H]([C@@H]2COC(C)(C)O2)[C@@H]1O |
| InChI | InChI=1S/C13H20O6/c1-5-7(2)13(16)10(14)9(18-11(13)15)8-6-17-12(3,4)19-8/h5,7-10,14,16H,1,6H2,2-4H3/t7-,8-,9+,10-,13-/m0/s1 |
| InChIKey | PEYRHECGDCBKMH-UNLLLRGISA-N |
| XLogP | -0.02 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|