C11H20N4OS — CID 113466215
4-amino-1-ethyl-3-methyl-N-(2-methylsulfanylpropyl)pyrazole-5-carboxamide (PubChem CID 113466215) has the molecular formula C11H20N4OS and a molecular weight of 256.37 g/mol. Its IUPAC name is 4-amino-1-ethyl-3-methyl-N-(2-methylsulfanylpropyl)pyrazole-5-carboxamide.
| Compound Name | 4-amino-1-ethyl-3-methyl-N-(2-methylsulfanylpropyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 113466215 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 4-amino-1-ethyl-3-methyl-N-(2-methylsulfanylpropyl)pyrazole-5-carboxamide |
| SMILES | CCn1nc(C)c(N)c1C(=O)NCC(C)SC |
| InChI | InChI=1S/C11H20N4OS/c1-5-15-10(9(12)8(3)14-15)11(16)13-6-7(2)17-4/h7H,5-6,12H2,1-4H3,(H,13,16) |
| InChIKey | YNQZHNCDFWBTEI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |