C12H22N4O2 — CID 66123504
4-amino-1-ethyl-N-(4-methoxybutyl)-3-methylpyrazole-5-carboxamide (PubChem CID 66123504) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-amino-1-ethyl-N-(4-methoxybutyl)-3-methylpyrazole-5-carboxamide.
| Compound Name | 4-amino-1-ethyl-N-(4-methoxybutyl)-3-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 66123504 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 4-amino-1-ethyl-N-(4-methoxybutyl)-3-methylpyrazole-5-carboxamide |
| SMILES | CCn1nc(C)c(N)c1C(=O)NCCCCOC |
| InChI | InChI=1S/C12H22N4O2/c1-4-16-11(10(13)9(2)15-16)12(17)14-7-5-6-8-18-3/h4-8,13H2,1-3H3,(H,14,17) |
| InChIKey | CJEDZUBMQVKQJJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|