C14H26N6O — CID 66123485
4-amino-1-ethyl-3-methyl-N-[2-(4-methylpiperazin-1-yl)ethyl]pyrazole-5-carboxamide (PubChem CID 66123485) has the molecular formula C14H26N6O and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-amino-1-ethyl-3-methyl-N-[2-(4-methylpiperazin-1-yl)ethyl]pyrazole-5-carboxamide.
| Compound Name | 4-amino-1-ethyl-3-methyl-N-[2-(4-methylpiperazin-1-yl)ethyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 66123485 |
| Molecular Formula | C14H26N6O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 4-amino-1-ethyl-3-methyl-N-[2-(4-methylpiperazin-1-yl)ethyl]pyrazole-5-carboxamide |
| SMILES | CCn1nc(C)c(N)c1C(=O)NCCN1CCN(C)CC1 |
| InChI | InChI=1S/C14H26N6O/c1-4-20-13(12(15)11(2)17-20)14(21)16-5-6-19-9-7-18(3)8-10-19/h4-10,15H2,1-3H3,(H,16,21) |
| InChIKey | CWYBLKBWHQIANL-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |