C17H19NO3 — CID 11346673
(1R,3aS,4R,5R,7aS)-1,5-dimethyl-3-oxo-N-phenyl-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxamide (PubChem CID 11346673) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is (1R,3aS,4R,5R,7aS)-1,5-dimethyl-3-oxo-N-phenyl-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxamide.
| Compound Name | (1R,3aS,4R,5R,7aS)-1,5-dimethyl-3-oxo-N-phenyl-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxamide |
|---|---|
| PubChem CID | 11346673 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (1R,3aS,4R,5R,7aS)-1,5-dimethyl-3-oxo-N-phenyl-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxamide |
| SMILES | C[C@@H]1C=C[C@H]2[C@H](C(=O)O[C@@H]2C)[C@@H]1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H19NO3/c1-10-8-9-13-11(2)21-17(20)15(13)14(10)16(19)18-12-6-4-3-5-7-12/h3-11,13-15H,1-2H3,(H,18,19)/t10-,11-,13-,14-,15+/m1/s1 |
| InChIKey | QLOVSWZRYQOQLG-BBIZWXPBSA-N |
| XLogP | 2.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|