C12H21N3O3 — CID 113467372
2-[4-[(3-methylcyclobutyl)carbamoyl]piperazin-1-yl]acetic acid (PubChem CID 113467372) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[4-[(3-methylcyclobutyl)carbamoyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[(3-methylcyclobutyl)carbamoyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 113467372 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-[4-[(3-methylcyclobutyl)carbamoyl]piperazin-1-yl]acetic acid |
| SMILES | CC1CC(NC(=O)N2CCN(CC(=O)O)CC2)C1 |
| InChI | InChI=1S/C12H21N3O3/c1-9-6-10(7-9)13-12(18)15-4-2-14(3-5-15)8-11(16)17/h9-10H,2-8H2,1H3,(H,13,18)(H,16,17) |
| InChIKey | ZJDSBLDNQPAYNT-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |