C12H20N4O4 — CID 63660923
2-[4-[(6-oxopiperidin-3-yl)carbamoyl]piperazin-1-yl]acetic acid (PubChem CID 63660923) has the molecular formula C12H20N4O4 and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-[4-[(6-oxopiperidin-3-yl)carbamoyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[(6-oxopiperidin-3-yl)carbamoyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 63660923 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-[4-[(6-oxopiperidin-3-yl)carbamoyl]piperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(C(=O)NC2CCC(=O)NC2)CC1 |
| InChI | InChI=1S/C12H20N4O4/c17-10-2-1-9(7-13-10)14-12(20)16-5-3-15(4-6-16)8-11(18)19/h9H,1-8H2,(H,13,17)(H,14,20)(H,18,19) |
| InChIKey | IJJYOTZMWSGRJO-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |