C11H20N2O6 — CID 113467941
4-[2-hydroxyethyl(2-methoxyethyl)carbamoyl]morpholine-3-carboxylic acid (PubChem CID 113467941) has the molecular formula C11H20N2O6 and a molecular weight of 276.29 g/mol. Its IUPAC name is 4-[2-hydroxyethyl(2-methoxyethyl)carbamoyl]morpholine-3-carboxylic acid.
| Compound Name | 4-[2-hydroxyethyl(2-methoxyethyl)carbamoyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 113467941 |
| Molecular Formula | C11H20N2O6 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4-[2-hydroxyethyl(2-methoxyethyl)carbamoyl]morpholine-3-carboxylic acid |
| SMILES | COCCN(CCO)C(=O)N1CCOCC1C(=O)O |
| InChI | InChI=1S/C11H20N2O6/c1-18-6-3-12(2-5-14)11(17)13-4-7-19-8-9(13)10(15)16/h9,14H,2-8H2,1H3,(H,15,16) |
| InChIKey | VTGGTZMNSSNVCJ-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |