C16H25NO4 — CID 11346966
2-O-tert-butyl 1-O-ethyl 1,3,4,5,6,7-hexahydroisoindole-1,2-dicarboxylate (PubChem CID 11346966) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-O-tert-butyl 1-O-ethyl 1,3,4,5,6,7-hexahydroisoindole-1,2-dicarboxylate.
| Compound Name | 2-O-tert-butyl 1-O-ethyl 1,3,4,5,6,7-hexahydroisoindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11346966 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-O-tert-butyl 1-O-ethyl 1,3,4,5,6,7-hexahydroisoindole-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1C2=C(CCCC2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25NO4/c1-5-20-14(18)13-12-9-7-6-8-11(12)10-17(13)15(19)21-16(2,3)4/h13H,5-10H2,1-4H3 |
| InChIKey | OFFSUHFMTVKCDZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|