About methyl 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-2-methylfuran-3-carboxylate
methyl 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 113472111) has the molecular formula C11H15F2NO4
and a molecular weight of 263.24 g/mol. Its IUPAC name is methyl 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-2-methylfuran-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-2-methylfuran-3-carboxylate |
| PubChem CID | 113472111 |
| Molecular Formula | C11H15F2NO4 |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | methyl 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CNCC(F)(F)CO)oc1C |
| InChI | InChI=1S/C11H15F2NO4/c1-7-9(10(16)17-2)3-8(18-7)4-14-5-11(12,13)6-15/h3,14-15H,4-6H2,1-2H3 |
| InChIKey | YHOCMOMONJYKTN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-2-methylfuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-2-methylfuran-3-carboxylate?
The IUPAC name of methyl 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-2-methylfuran-3-carboxylate (CID 113472111) is methyl 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-2-methylfuran-3-carboxylate.
What is the SMILES notation for methyl 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-2-methylfuran-3-carboxylate?
The canonical SMILES for methyl 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-2-methylfuran-3-carboxylate is COC(=O)c1cc(CNCC(F)(F)CO)oc1C.
What is the InChIKey of methyl 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-2-methylfuran-3-carboxylate?
The InChIKey is YHOCMOMONJYKTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2NO4/c1-7-9(10(16)17-2)3-8(18-7)4-14-5-11(12,13)6-15/h3,14-15H,4-6H2,1-2H3.
What are the key properties of methyl 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-2-methylfuran-3-carboxylate?
methyl 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-2-methylfuran-3-carboxylate has a molecular weight of 263.24 g/mol, XLogP of 1.09, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]-2-methylfuran-3-carboxylate is sourced from PubChem (CID 113472111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).