C15H19NOS — CID 113472367
(2-tert-butyl-1,3-thiazol-4-yl)-(3-methylphenyl)methanol (PubChem CID 113472367) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is (2-tert-butyl-1,3-thiazol-4-yl)-(3-methylphenyl)methanol.
| Compound Name | (2-tert-butyl-1,3-thiazol-4-yl)-(3-methylphenyl)methanol |
|---|---|
| PubChem CID | 113472367 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | (2-tert-butyl-1,3-thiazol-4-yl)-(3-methylphenyl)methanol |
| SMILES | Cc1cccc(C(O)c2csc(C(C)(C)C)n2)c1 |
| InChI | InChI=1S/C15H19NOS/c1-10-6-5-7-11(8-10)13(17)12-9-18-14(16-12)15(2,3)4/h5-9,13,17H,1-4H3 |
| InChIKey | PJVHDLLLJNWIQC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |