C16H21NO3S — CID 116809869
(2-tert-butyl-1,3-thiazol-4-yl)-(2,6-dimethoxyphenyl)methanol (PubChem CID 116809869) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is (2-tert-butyl-1,3-thiazol-4-yl)-(2,6-dimethoxyphenyl)methanol.
| Compound Name | (2-tert-butyl-1,3-thiazol-4-yl)-(2,6-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 116809869 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (2-tert-butyl-1,3-thiazol-4-yl)-(2,6-dimethoxyphenyl)methanol |
| SMILES | COc1cccc(OC)c1C(O)c1csc(C(C)(C)C)n1 |
| InChI | InChI=1S/C16H21NO3S/c1-16(2,3)15-17-10(9-21-15)14(18)13-11(19-4)7-6-8-12(13)20-5/h6-9,14,18H,1-5H3 |
| InChIKey | MGCHSMRDWWWZPX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |