C13H13ClO3S — CID 80529656
(3-chlorothiophen-2-yl)-(2,6-dimethoxyphenyl)methanol (PubChem CID 80529656) has the molecular formula C13H13ClO3S and a molecular weight of 284.76 g/mol. Its IUPAC name is (3-chlorothiophen-2-yl)-(2,6-dimethoxyphenyl)methanol.
| Compound Name | (3-chlorothiophen-2-yl)-(2,6-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 80529656 |
| Molecular Formula | C13H13ClO3S |
| Molecular Weight | 284.76 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | (3-chlorothiophen-2-yl)-(2,6-dimethoxyphenyl)methanol |
| SMILES | COc1cccc(OC)c1C(O)c1sccc1Cl |
| InChI | InChI=1S/C13H13ClO3S/c1-16-9-4-3-5-10(17-2)11(9)12(15)13-8(14)6-7-18-13/h3-7,12,15H,1-2H3 |
| InChIKey | OMCATDCTKOGPTH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.76 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |