C13H12Cl2O2S — CID 80530505
3-chloro-2-[chloro-(2,6-dimethoxyphenyl)methyl]thiophene (PubChem CID 80530505) has the molecular formula C13H12Cl2O2S and a molecular weight of 303.21 g/mol. Its IUPAC name is 3-chloro-2-[chloro-(2,6-dimethoxyphenyl)methyl]thiophene.
| Compound Name | 3-chloro-2-[chloro-(2,6-dimethoxyphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 80530505 |
| Molecular Formula | C13H12Cl2O2S |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 3-chloro-2-[chloro-(2,6-dimethoxyphenyl)methyl]thiophene |
| SMILES | COc1cccc(OC)c1C(Cl)c1sccc1Cl |
| InChI | InChI=1S/C13H12Cl2O2S/c1-16-9-4-3-5-10(17-2)11(9)12(15)13-8(14)6-7-18-13/h3-7,12H,1-2H3 |
| InChIKey | FHEWCLFDVHNUQY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|