C15H23NS2 — CID 113474406
N-[[4-(3-ethylsulfanylpropylsulfanyl)phenyl]methyl]cyclopropanamine (PubChem CID 113474406) has the molecular formula C15H23NS2 and a molecular weight of 281.49 g/mol. Its IUPAC name is N-[[4-(3-ethylsulfanylpropylsulfanyl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[4-(3-ethylsulfanylpropylsulfanyl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 113474406 |
| Molecular Formula | C15H23NS2 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | N-[[4-(3-ethylsulfanylpropylsulfanyl)phenyl]methyl]cyclopropanamine |
| SMILES | CCSCCCSc1ccc(CNC2CC2)cc1 |
| InChI | InChI=1S/C15H23NS2/c1-2-17-10-3-11-18-15-8-4-13(5-9-15)12-16-14-6-7-14/h4-5,8-9,14,16H,2-3,6-7,10-12H2,1H3 |
| InChIKey | WJBQQEKDQJOBFA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|