C15H24O2S — CID 113474719
5-ethylsulfanyl-2-[(3-methoxyphenyl)methyl]pentan-1-ol (PubChem CID 113474719) has the molecular formula C15H24O2S and a molecular weight of 268.42 g/mol. Its IUPAC name is 5-ethylsulfanyl-2-[(3-methoxyphenyl)methyl]pentan-1-ol.
| Compound Name | 5-ethylsulfanyl-2-[(3-methoxyphenyl)methyl]pentan-1-ol |
|---|---|
| PubChem CID | 113474719 |
| Molecular Formula | C15H24O2S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 5-ethylsulfanyl-2-[(3-methoxyphenyl)methyl]pentan-1-ol |
| SMILES | CCSCCCC(CO)Cc1cccc(OC)c1 |
| InChI | InChI=1S/C15H24O2S/c1-3-18-9-5-7-14(12-16)10-13-6-4-8-15(11-13)17-2/h4,6,8,11,14,16H,3,5,7,9-10,12H2,1-2H3 |
| InChIKey | MLTZVDADKSYPOA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|