C10H22N2O4S — CID 113475611
2-amino-N-(1-hydroxy-2-methylpropan-2-yl)-N-methyl-4-methylsulfonylbutanamide (PubChem CID 113475611) has the molecular formula C10H22N2O4S and a molecular weight of 266.36 g/mol. Its IUPAC name is 2-amino-N-(1-hydroxy-2-methylpropan-2-yl)-N-methyl-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-(1-hydroxy-2-methylpropan-2-yl)-N-methyl-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 113475611 |
| Molecular Formula | C10H22N2O4S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-amino-N-(1-hydroxy-2-methylpropan-2-yl)-N-methyl-4-methylsulfonylbutanamide |
| SMILES | CN(C(=O)C(N)CCS(C)(=O)=O)C(C)(C)CO |
| InChI | InChI=1S/C10H22N2O4S/c1-10(2,7-13)12(3)9(14)8(11)5-6-17(4,15)16/h8,13H,5-7,11H2,1-4H3 |
| InChIKey | ZTSWDFMDHCNBRM-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |