C11H13N3O3S — CID 113475823
2-[(cyclopent-3-en-1-ylcarbamoylamino)methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 113475823) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-[(cyclopent-3-en-1-ylcarbamoylamino)methyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(cyclopent-3-en-1-ylcarbamoylamino)methyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 113475823 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-[(cyclopent-3-en-1-ylcarbamoylamino)methyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(NCc1nc(C(=O)O)cs1)NC1CC=CC1 |
| InChI | InChI=1S/C11H13N3O3S/c15-10(16)8-6-18-9(14-8)5-12-11(17)13-7-3-1-2-4-7/h1-2,6-7H,3-5H2,(H,15,16)(H2,12,13,17) |
| InChIKey | QYOCEOSAPYGSCH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|