C11H12N2O3S — CID 66380657
2-[(cyclopent-3-ene-1-carbonylamino)methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66380657) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-[(cyclopent-3-ene-1-carbonylamino)methyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(cyclopent-3-ene-1-carbonylamino)methyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66380657 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-[(cyclopent-3-ene-1-carbonylamino)methyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(CNC(=O)C2CC=CC2)n1 |
| InChI | InChI=1S/C11H12N2O3S/c14-10(7-3-1-2-4-7)12-5-9-13-8(6-17-9)11(15)16/h1-2,6-7H,3-5H2,(H,12,14)(H,15,16) |
| InChIKey | SSDJPYQLQHYBBO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|