C15H30N2S — CID 113478249
3-ethyl-2-(4-methylsulfanylbutan-2-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 113478249) has the molecular formula C15H30N2S and a molecular weight of 270.49 g/mol. Its IUPAC name is 3-ethyl-2-(4-methylsulfanylbutan-2-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 3-ethyl-2-(4-methylsulfanylbutan-2-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 113478249 |
| Molecular Formula | C15H30N2S |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 3-ethyl-2-(4-methylsulfanylbutan-2-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | CCC1CN2CCCCC2CN1C(C)CCSC |
| InChI | InChI=1S/C15H30N2S/c1-4-14-11-16-9-6-5-7-15(16)12-17(14)13(2)8-10-18-3/h13-15H,4-12H2,1-3H3 |
| InChIKey | DOKQLSJGXUUTEZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |