C18H36N2 — CID 106027236
3-ethyl-2-octan-4-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 106027236) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is 3-ethyl-2-octan-4-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 3-ethyl-2-octan-4-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 106027236 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | 3-ethyl-2-octan-4-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | CCCCC(CCC)N1CC2CCCCN2CC1CC |
| InChI | InChI=1S/C18H36N2/c1-4-7-11-17(10-5-2)20-15-18-12-8-9-13-19(18)14-16(20)6-3/h16-18H,4-15H2,1-3H3 |
| InChIKey | ZIKOSMSCFBWZGD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |