C13H22F4N2 — CID 103740100
3-ethyl-2-(2,2,3,3-tetrafluoropropyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 103740100) has the molecular formula C13H22F4N2 and a molecular weight of 282.32 g/mol. Its IUPAC name is 3-ethyl-2-(2,2,3,3-tetrafluoropropyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 3-ethyl-2-(2,2,3,3-tetrafluoropropyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 103740100 |
| Molecular Formula | C13H22F4N2 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 3-ethyl-2-(2,2,3,3-tetrafluoropropyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | CCC1CN2CCCCC2CN1CC(F)(F)C(F)F |
| InChI | InChI=1S/C13H22F4N2/c1-2-10-7-18-6-4-3-5-11(18)8-19(10)9-13(16,17)12(14)15/h10-12H,2-9H2,1H3 |
| InChIKey | MDOMRTUXQSZWPC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|