C17H32N2O — CID 104576466
3-ethyl-2-[2-(oxan-2-yl)ethyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 104576466) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is 3-ethyl-2-[2-(oxan-2-yl)ethyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 3-ethyl-2-[2-(oxan-2-yl)ethyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 104576466 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | 3-ethyl-2-[2-(oxan-2-yl)ethyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | CCC1CN2CCCCC2CN1CCC1CCCCO1 |
| InChI | InChI=1S/C17H32N2O/c1-2-15-13-18-10-5-3-7-16(18)14-19(15)11-9-17-8-4-6-12-20-17/h15-17H,2-14H2,1H3 |
| InChIKey | VAVZDVZUBGJYMW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |