C15H29N3S — CID 103857691
4-[2-(3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)ethyl]thiomorpholine (PubChem CID 103857691) has the molecular formula C15H29N3S and a molecular weight of 283.48 g/mol. Its IUPAC name is 4-[2-(3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)ethyl]thiomorpholine.
| Compound Name | 4-[2-(3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)ethyl]thiomorpholine |
|---|---|
| PubChem CID | 103857691 |
| Molecular Formula | C15H29N3S |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 4-[2-(3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)ethyl]thiomorpholine |
| SMILES | CCC1CN2CCCC2CN1CCN1CCSCC1 |
| InChI | InChI=1S/C15H29N3S/c1-2-14-12-17-5-3-4-15(17)13-18(14)7-6-16-8-10-19-11-9-16/h14-15H,2-13H2,1H3 |
| InChIKey | OYPNFBKGQXWMTF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |