C12H20F4N2 — CID 95634847
(3R)-3-pyrrolidin-1-yl-1-(2,2,3,3-tetrafluoropropyl)piperidine (PubChem CID 95634847) has the molecular formula C12H20F4N2 and a molecular weight of 268.30 g/mol. Its IUPAC name is (3R)-3-pyrrolidin-1-yl-1-(2,2,3,3-tetrafluoropropyl)piperidine.
| Compound Name | (3R)-3-pyrrolidin-1-yl-1-(2,2,3,3-tetrafluoropropyl)piperidine |
|---|---|
| PubChem CID | 95634847 |
| Molecular Formula | C12H20F4N2 |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (3R)-3-pyrrolidin-1-yl-1-(2,2,3,3-tetrafluoropropyl)piperidine |
| SMILES | FC(F)C(F)(F)CN1CCC[C@@H](N2CCCC2)C1 |
| InChI | InChI=1S/C12H20F4N2/c13-11(14)12(15,16)9-17-5-3-4-10(8-17)18-6-1-2-7-18/h10-11H,1-9H2/t10-/m1/s1 |
| InChIKey | KZYCNGKNAAFNSS-SNVBAGLBSA-N |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|