C10H17F3N2 — CID 175318874
3-pyrrolidin-1-yl-1-(2,2,2-trifluoroethyl)pyrrolidine (PubChem CID 175318874) has the molecular formula C10H17F3N2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 3-pyrrolidin-1-yl-1-(2,2,2-trifluoroethyl)pyrrolidine.
| Compound Name | 3-pyrrolidin-1-yl-1-(2,2,2-trifluoroethyl)pyrrolidine |
|---|---|
| PubChem CID | 175318874 |
| Molecular Formula | C10H17F3N2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 3-pyrrolidin-1-yl-1-(2,2,2-trifluoroethyl)pyrrolidine |
| SMILES | FC(F)(F)CN1CCC(N2CCCC2)C1 |
| InChI | InChI=1S/C10H17F3N2/c11-10(12,13)8-14-6-3-9(7-14)15-4-1-2-5-15/h9H,1-8H2 |
| InChIKey | BPDBWBZNJHVNDL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |