C17H29F3N4O — CID 126795613
N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxamide (PubChem CID 126795613) has the molecular formula C17H29F3N4O and a molecular weight of 362.44 g/mol. Its IUPAC name is N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxamide.
| Compound Name | N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 126795613 |
| Molecular Formula | C17H29F3N4O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxamide |
| SMILES | O=C(NCC1CCN(CC(F)(F)F)CC1)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C17H29F3N4O/c18-17(19,20)13-22-7-4-14(5-8-22)11-21-16(25)24-10-9-23-6-2-1-3-15(23)12-24/h14-15H,1-13H2,(H,21,25) |
| InChIKey | QXPUIODGQFXHHD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |