C13H25N3O — CID 115585902
N-tert-butyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxamide (PubChem CID 115585902) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is N-tert-butyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxamide.
| Compound Name | N-tert-butyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 115585902 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | N-tert-butyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C13H25N3O/c1-13(2,3)14-12(17)16-9-8-15-7-5-4-6-11(15)10-16/h11H,4-10H2,1-3H3,(H,14,17) |
| InChIKey | YFHJWRLJSBIBGG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |