C9H14ClF3N2O — CID 50989385
2-chloro-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]acetamide (PubChem CID 50989385) has the molecular formula C9H14ClF3N2O and a molecular weight of 258.67 g/mol. Its IUPAC name is 2-chloro-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]acetamide.
| Compound Name | 2-chloro-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 50989385 |
| Molecular Formula | C9H14ClF3N2O |
| Molecular Weight | 258.67 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-chloro-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]acetamide |
| SMILES | O=C(CCl)NCC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C9H14ClF3N2O/c10-3-8(16)14-4-7-1-2-15(5-7)6-9(11,12)13/h7H,1-6H2,(H,14,16) |
| InChIKey | KHVFYCQRKUEUPY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.67 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|