C13H24F3N3O — CID 60856493
6-amino-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]hexanamide (PubChem CID 60856493) has the molecular formula C13H24F3N3O and a molecular weight of 295.35 g/mol. Its IUPAC name is 6-amino-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]hexanamide.
| Compound Name | 6-amino-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]hexanamide |
|---|---|
| PubChem CID | 60856493 |
| Molecular Formula | C13H24F3N3O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 6-amino-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]hexanamide |
| SMILES | NCCCCCC(=O)NCC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C13H24F3N3O/c14-13(15,16)10-19-7-5-11(9-19)8-18-12(20)4-2-1-3-6-17/h11H,1-10,17H2,(H,18,20) |
| InChIKey | SZANWBLRLXCTMT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|