C12H21N3OS — CID 113478489
4-amino-1-ethyl-N-(2-methyl-2-methylsulfanylpropyl)pyrrole-2-carboxamide (PubChem CID 113478489) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is 4-amino-1-ethyl-N-(2-methyl-2-methylsulfanylpropyl)pyrrole-2-carboxamide.
| Compound Name | 4-amino-1-ethyl-N-(2-methyl-2-methylsulfanylpropyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 113478489 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 4-amino-1-ethyl-N-(2-methyl-2-methylsulfanylpropyl)pyrrole-2-carboxamide |
| SMILES | CCn1cc(N)cc1C(=O)NCC(C)(C)SC |
| InChI | InChI=1S/C12H21N3OS/c1-5-15-7-9(13)6-10(15)11(16)14-8-12(2,3)17-4/h6-7H,5,8,13H2,1-4H3,(H,14,16) |
| InChIKey | AWNMRPPAYWLOPN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |